C14H10ClFN4O2 — CID 139408179
1-(2-chloro-5-fluoropyrimidin-4-yl)-5-methoxyindole-3-carboxamide (PubChem CID 139408179) has the molecular formula C14H10ClFN4O2 and a molecular weight of 320.71 g/mol. Its IUPAC name is 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-methoxyindole-3-carboxamide.
| Compound Name | 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-methoxyindole-3-carboxamide |
|---|---|
| PubChem CID | 139408179 |
| Molecular Formula | C14H10ClFN4O2 |
| Molecular Weight | 320.71 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-methoxyindole-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(C(N)=O)cn2-c1nc(Cl)ncc1F |
| InChI | InChI=1S/C14H10ClFN4O2/c1-22-7-2-3-11-8(4-7)9(12(17)21)6-20(11)13-10(16)5-18-14(15)19-13/h2-6H,1H3,(H2,17,21) |
| InChIKey | YHNCRAYZWQKWNI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |