C22H17FN4O4 — CID 90946247
(3-carbamoyl-5-methoxyindol-1-yl) 2-(3-fluorophenyl)-4-methylpyrimidine-5-carboxylate (PubChem CID 90946247) has the molecular formula C22H17FN4O4 and a molecular weight of 420.40 g/mol. Its IUPAC name is (3-carbamoyl-5-methoxyindol-1-yl) 2-(3-fluorophenyl)-4-methylpyrimidine-5-carboxylate.
| Compound Name | (3-carbamoyl-5-methoxyindol-1-yl) 2-(3-fluorophenyl)-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90946247 |
| Molecular Formula | C22H17FN4O4 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (3-carbamoyl-5-methoxyindol-1-yl) 2-(3-fluorophenyl)-4-methylpyrimidine-5-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(N)=O)cn2OC(=O)c1cnc(-c2cccc(F)c2)nc1C |
| InChI | InChI=1S/C22H17FN4O4/c1-12-17(10-25-21(26-12)13-4-3-5-14(23)8-13)22(29)31-27-11-18(20(24)28)16-9-15(30-2)6-7-19(16)27/h3-11H,1-2H3,(H2,24,28) |
| InChIKey | PAZSBZIUXSJHSG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |