C21H16FN5O3 — CID 91039544
(3-carbamoyl-5-fluoro-2-methylindol-1-yl) 4-methyl-2-pyridin-3-ylpyrimidine-5-carboxylate (PubChem CID 91039544) has the molecular formula C21H16FN5O3 and a molecular weight of 405.39 g/mol. Its IUPAC name is (3-carbamoyl-5-fluoro-2-methylindol-1-yl) 4-methyl-2-pyridin-3-ylpyrimidine-5-carboxylate.
| Compound Name | (3-carbamoyl-5-fluoro-2-methylindol-1-yl) 4-methyl-2-pyridin-3-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91039544 |
| Molecular Formula | C21H16FN5O3 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (3-carbamoyl-5-fluoro-2-methylindol-1-yl) 4-methyl-2-pyridin-3-ylpyrimidine-5-carboxylate |
| SMILES | Cc1nc(-c2cccnc2)ncc1C(=O)On1c(C)c(C(N)=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H16FN5O3/c1-11-16(10-25-20(26-11)13-4-3-7-24-9-13)21(29)30-27-12(2)18(19(23)28)15-8-14(22)5-6-17(15)27/h3-10H,1-2H3,(H2,23,28) |
| InChIKey | GXLPOZWTCSQOPB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |