C20H15N5O5S — CID 91143924
(3-carbamoyl-5-methylsulfonylindol-1-yl) 2-pyridin-3-ylpyrimidine-5-carboxylate (PubChem CID 91143924) has the molecular formula C20H15N5O5S and a molecular weight of 437.44 g/mol. Its IUPAC name is (3-carbamoyl-5-methylsulfonylindol-1-yl) 2-pyridin-3-ylpyrimidine-5-carboxylate.
| Compound Name | (3-carbamoyl-5-methylsulfonylindol-1-yl) 2-pyridin-3-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91143924 |
| Molecular Formula | C20H15N5O5S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (3-carbamoyl-5-methylsulfonylindol-1-yl) 2-pyridin-3-ylpyrimidine-5-carboxylate |
| SMILES | CS(=O)(=O)c1ccc2c(c1)c(C(N)=O)cn2OC(=O)c1cnc(-c2cccnc2)nc1 |
| InChI | InChI=1S/C20H15N5O5S/c1-31(28,29)14-4-5-17-15(7-14)16(18(21)26)11-25(17)30-20(27)13-9-23-19(24-10-13)12-3-2-6-22-8-12/h2-11H,1H3,(H2,21,26) |
| InChIKey | CBQRBLGTSWXIKC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |