C14H14FN5O4 — CID 139414089
(1S,4S)-5-(7-fluoro-2-methyl-5-nitroindazol-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 139414089) has the molecular formula C14H14FN5O4 and a molecular weight of 335.30 g/mol. Its IUPAC name is (1S,4S)-5-(7-fluoro-2-methyl-5-nitroindazol-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,4S)-5-(7-fluoro-2-methyl-5-nitroindazol-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 139414089 |
| Molecular Formula | C14H14FN5O4 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (1S,4S)-5-(7-fluoro-2-methyl-5-nitroindazol-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cn1cc2c(N3C[C@@H]4C[C@H]3CN4C(=O)O)c([N+](=O)[O-])cc(F)c2n1 |
| InChI | InChI=1S/C14H14FN5O4/c1-17-6-9-12(16-17)10(15)3-11(20(23)24)13(9)18-4-8-2-7(18)5-19(8)14(21)22/h3,6-8H,2,4-5H2,1H3,(H,21,22)/t7-,8-/m0/s1 |
| InChIKey | YHRQJVOHKZJCRD-YUMQZZPRSA-N |
| XLogP | 1.56 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|