C14H11BrFN5O4 — CID 174191485
(1R,5R)-6-(7-bromo-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 174191485) has the molecular formula C14H11BrFN5O4 and a molecular weight of 412.18 g/mol. Its IUPAC name is (1R,5R)-6-(7-bromo-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (1R,5R)-6-(7-bromo-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 174191485 |
| Molecular Formula | C14H11BrFN5O4 |
| Molecular Weight | 412.18 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | (1R,5R)-6-(7-bromo-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@H]2[C@H]1CN2c1c([N+](=O)[O-])cnc2c(F)c(Br)ncc12 |
| InChI | InChI=1S/C14H11BrFN5O4/c15-13-10(16)11-6(3-18-13)12(8(4-17-11)21(24)25)20-5-9-7(20)1-2-19(9)14(22)23/h3-4,7,9H,1-2,5H2,(H,22,23)/t7-,9-/m1/s1 |
| InChIKey | HQERIVHPZXWRDI-VXNVDRBHSA-N |
| XLogP | 2.38 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|