C26H31N7O3 — CID 139420147
methanimidoyl 5-methyl-6-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]pyridine-3-carboximidate (PubChem CID 139420147) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is methanimidoyl 5-methyl-6-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]pyridine-3-carboximidate.
| Compound Name | methanimidoyl 5-methyl-6-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 139420147 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | methanimidoyl 5-methyl-6-[[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]amino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\O/C=N/[H])c1cnc(NC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)c(C)c1 |
| InChI | InChI=1S/C26H31N7O3/c1-17-12-18(25(28)35-16-27)15-31-26(17)32-19-2-4-21(5-3-19)36-23-14-20(33-8-10-34-11-9-33)13-22-24(23)30-7-6-29-22/h6-7,12-16,19,21,27-28H,2-5,8-11H2,1H3,(H,31,32)/b27-16+,28-25- |
| InChIKey | KPGYRCZETJUXMC-DGTJGKBUSA-N |
| XLogP | 3.92 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|