C36H68N4O3 — CID 139423862
propan-2-yl (4R)-4-[(3S,7R,10S,13R)-3-[3-[bis(3-aminopropyl)amino]propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 139423862) has the molecular formula C36H68N4O3 and a molecular weight of 604.97 g/mol. Its IUPAC name is propan-2-yl (4R)-4-[(3S,7R,10S,13R)-3-[3-[bis(3-aminopropyl)amino]propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | propan-2-yl (4R)-4-[(3S,7R,10S,13R)-3-[3-[bis(3-aminopropyl)amino]propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 139423862 |
| Molecular Formula | C36H68N4O3 |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.53 |
| IUPAC Name | propan-2-yl (4R)-4-[(3S,7R,10S,13R)-3-[3-[bis(3-aminopropyl)amino]propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC(C)OC(=O)CC[C@@H](C)C1CCC2C3C(O)CC4C[C@@H](NCCCN(CCCN)CCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H68N4O3/c1-25(2)43-33(42)12-9-26(3)29-10-11-30-34-31(14-16-36(29,30)5)35(4)15-13-28(23-27(35)24-32(34)41)39-19-8-22-40(20-6-17-37)21-7-18-38/h25-32,34,39,41H,6-24,37-38H2,1-5H3/t26-,27?,28+,29?,30?,31?,32?,34?,35+,36-/m1/s1 |
| InChIKey | VFADERXJEPWKSA-WWBVOSAESA-N |
| XLogP | 5.33 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|