C15H17N3O4S2 — CID 139428077
ethyl 4-cyclopropyl-2-[[2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 139428077) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 4-cyclopropyl-2-[[2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-cyclopropyl-2-[[2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 139428077 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | ethyl 4-cyclopropyl-2-[[2-(2-imino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | [H]/N=C1\NC(=O)C(CC(=O)Nc2scc(C3CC3)c2C(=O)OCC)S1 |
| InChI | InChI=1S/C15H17N3O4S2/c1-2-22-14(21)11-8(7-3-4-7)6-23-13(11)17-10(19)5-9-12(20)18-15(16)24-9/h6-7,9H,2-5H2,1H3,(H,17,19)(H2,16,18,20) |
| InChIKey | NPNLHUUZZMHIFP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|