C22H20N2O4S2 — CID 139432975
4-[1,1-bis[(2-aminophenyl)sulfanyl]ethoxycarbonyl]benzoic acid (PubChem CID 139432975) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-[1,1-bis[(2-aminophenyl)sulfanyl]ethoxycarbonyl]benzoic acid.
| Compound Name | 4-[1,1-bis[(2-aminophenyl)sulfanyl]ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 139432975 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4-[1,1-bis[(2-aminophenyl)sulfanyl]ethoxycarbonyl]benzoic acid |
| SMILES | CC(OC(=O)c1ccc(C(=O)O)cc1)(Sc1ccccc1N)Sc1ccccc1N |
| InChI | InChI=1S/C22H20N2O4S2/c1-22(29-18-8-4-2-6-16(18)23,30-19-9-5-3-7-17(19)24)28-21(27)15-12-10-14(11-13-15)20(25)26/h2-13H,23-24H2,1H3,(H,25,26) |
| InChIKey | JEWJVULWCDBEBH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|