C17H11F3O3 — CID 139433145
4-phenyl-6-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 139433145) has the molecular formula C17H11F3O3 and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-phenyl-6-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 4-phenyl-6-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 139433145 |
| Molecular Formula | C17H11F3O3 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-phenyl-6-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=C(c2ccccc2)c2cc(C(F)(F)F)ccc2OC1 |
| InChI | InChI=1S/C17H11F3O3/c18-17(19,20)11-6-7-14-12(8-11)15(10-4-2-1-3-5-10)13(9-23-14)16(21)22/h1-8H,9H2,(H,21,22) |
| InChIKey | NDVCBWYBOMLCQP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |