C22H22F3NO — CID 66837167
1-[[4-[4-(trifluoromethyl)phenyl]-2H-chromen-3-yl]methyl]piperidine (PubChem CID 66837167) has the molecular formula C22H22F3NO and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[[4-[4-(trifluoromethyl)phenyl]-2H-chromen-3-yl]methyl]piperidine.
| Compound Name | 1-[[4-[4-(trifluoromethyl)phenyl]-2H-chromen-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 66837167 |
| Molecular Formula | C22H22F3NO |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[[4-[4-(trifluoromethyl)phenyl]-2H-chromen-3-yl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(C2=C(CN3CCCCC3)COc3ccccc32)cc1 |
| InChI | InChI=1S/C22H22F3NO/c23-22(24,25)18-10-8-16(9-11-18)21-17(14-26-12-4-1-5-13-26)15-27-20-7-3-2-6-19(20)21/h2-3,6-11H,1,4-5,12-15H2 |
| InChIKey | SQXSMXHQHZSQDY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |