C20H19N3O4S2 — CID 139439223
[2-[[2-amino-6-(4-aminophenyl)sulfanylbenzoyl]amino]phenyl] methanesulfonate (PubChem CID 139439223) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-[[2-amino-6-(4-aminophenyl)sulfanylbenzoyl]amino]phenyl] methanesulfonate.
| Compound Name | [2-[[2-amino-6-(4-aminophenyl)sulfanylbenzoyl]amino]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 139439223 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [2-[[2-amino-6-(4-aminophenyl)sulfanylbenzoyl]amino]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccccc1NC(=O)c1c(N)cccc1Sc1ccc(N)cc1 |
| InChI | InChI=1S/C20H19N3O4S2/c1-29(25,26)27-17-7-3-2-6-16(17)23-20(24)19-15(22)5-4-8-18(19)28-14-11-9-13(21)10-12-14/h2-12H,21-22H2,1H3,(H,23,24) |
| InChIKey | FWJQXTVBDATJBV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|