C21H18N2O4S — CID 71811804
4-[3-amino-2-[(2-methoxyphenyl)carbamoyl]phenyl]sulfanylbenzoic acid (PubChem CID 71811804) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 4-[3-amino-2-[(2-methoxyphenyl)carbamoyl]phenyl]sulfanylbenzoic acid.
| Compound Name | 4-[3-amino-2-[(2-methoxyphenyl)carbamoyl]phenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 71811804 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-[3-amino-2-[(2-methoxyphenyl)carbamoyl]phenyl]sulfanylbenzoic acid |
| SMILES | COc1ccccc1NC(=O)c1c(N)cccc1Sc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H18N2O4S/c1-27-17-7-3-2-6-16(17)23-20(24)19-15(22)5-4-8-18(19)28-14-11-9-13(10-12-14)21(25)26/h2-12H,22H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | HHNXXHUHODEFII-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|