C20H19N3O8S2 — CID 118387004
2-amino-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;sulfuric acid (PubChem CID 118387004) has the molecular formula C20H19N3O8S2 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;sulfuric acid.
| Compound Name | 2-amino-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;sulfuric acid |
|---|---|
| PubChem CID | 118387004 |
| Molecular Formula | C20H19N3O8S2 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-amino-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;sulfuric acid |
| SMILES | COc1ccccc1NC(=O)c1c(N)cccc1Sc1ccc([N+](=O)[O-])cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C20H17N3O4S.H2O4S/c1-27-17-7-3-2-6-16(17)22-20(24)19-15(21)5-4-8-18(19)28-14-11-9-13(10-12-14)23(25)26;1-5(2,3)4/h2-12H,21H2,1H3,(H,22,24);(H2,1,2,3,4) |
| InChIKey | AGWZEDVBRZBOFO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|