C21H19ClN4O5S — CID 141328022
2-(carbamoylamino)-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;hydrochloride (PubChem CID 141328022) has the molecular formula C21H19ClN4O5S and a molecular weight of 474.93 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;hydrochloride.
| Compound Name | 2-(carbamoylamino)-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 141328022 |
| Molecular Formula | C21H19ClN4O5S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 2-(carbamoylamino)-N-(2-methoxyphenyl)-6-(4-nitrophenyl)sulfanylbenzamide;hydrochloride |
| SMILES | COc1ccccc1NC(=O)c1c(NC(N)=O)cccc1Sc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C21H18N4O5S.ClH/c1-30-17-7-3-2-5-15(17)23-20(26)19-16(24-21(22)27)6-4-8-18(19)31-14-11-9-13(10-12-14)25(28)29;/h2-12H,1H3,(H,23,26)(H3,22,24,27);1H |
| InChIKey | XFTANBKZZYMJAL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|