C28H32F4N4O2 — CID 139444836
[(4S,5R)-5-[[[(E)-1-(4-fluorophenyl)but-3-enylideneamino]-methylamino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 139444836) has the molecular formula C28H32F4N4O2 and a molecular weight of 532.58 g/mol. Its IUPAC name is [(4S,5R)-5-[[[(E)-1-(4-fluorophenyl)but-3-enylideneamino]-methylamino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(4S,5R)-5-[[[(E)-1-(4-fluorophenyl)but-3-enylideneamino]-methylamino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 139444836 |
| Molecular Formula | C28H32F4N4O2 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | [(4S,5R)-5-[[[(E)-1-(4-fluorophenyl)but-3-enylideneamino]-methylamino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | C=CC/C(=N\N(C)C[C@H]1CN2CC[C@H]1CC2COC(=O)Nc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H32F4N4O2/c1-3-5-26(19-8-10-23(29)11-9-19)34-35(2)16-21-17-36-13-12-20(21)14-25(36)18-38-27(37)33-24-7-4-6-22(15-24)28(30,31)32/h3-4,6-11,15,20-21,25H,1,5,12-14,16-18H2,2H3,(H,33,37)/b34-26+/t20-,21-,25?/m0/s1 |
| InChIKey | XBWVVXHZUWEAMI-DNAGXWPWSA-N |
| XLogP | 6.02 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|