C14H21N3 — CID 139448072
1-heptan-2-yl-3-methylpyrazolo[5,4-b]pyridine (PubChem CID 139448072) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-heptan-2-yl-3-methylpyrazolo[5,4-b]pyridine.
| Compound Name | 1-heptan-2-yl-3-methylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 139448072 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-heptan-2-yl-3-methylpyrazolo[5,4-b]pyridine |
| SMILES | CCCCCC(C)n1nc(C)c2cccnc21 |
| InChI | InChI=1S/C14H21N3/c1-4-5-6-8-11(2)17-14-13(12(3)16-17)9-7-10-15-14/h7,9-11H,4-6,8H2,1-3H3 |
| InChIKey | VUASBUVIYXDRON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|