C19H29F2N3O — CID 166836172
2,2-difluoro-3-(1-heptan-2-yl-3-methylindazol-5-yl)oxy-N-methylpropan-1-amine (PubChem CID 166836172) has the molecular formula C19H29F2N3O and a molecular weight of 353.46 g/mol. Its IUPAC name is 2,2-difluoro-3-(1-heptan-2-yl-3-methylindazol-5-yl)oxy-N-methylpropan-1-amine.
| Compound Name | 2,2-difluoro-3-(1-heptan-2-yl-3-methylindazol-5-yl)oxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 166836172 |
| Molecular Formula | C19H29F2N3O |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 2,2-difluoro-3-(1-heptan-2-yl-3-methylindazol-5-yl)oxy-N-methylpropan-1-amine |
| SMILES | CCCCCC(C)n1nc(C)c2cc(OCC(F)(F)CNC)ccc21 |
| InChI | InChI=1S/C19H29F2N3O/c1-5-6-7-8-14(2)24-18-10-9-16(11-17(18)15(3)23-24)25-13-19(20,21)12-22-4/h9-11,14,22H,5-8,12-13H2,1-4H3 |
| InChIKey | APLCLAGSDQHPAZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|