C9H9Cl2N3O3 — CID 139449306
(E)-2-amino-3-(3,4-dichlorophenoxy)-3-hydrazinylprop-2-enoic acid (PubChem CID 139449306) has the molecular formula C9H9Cl2N3O3 and a molecular weight of 278.10 g/mol. Its IUPAC name is (E)-2-amino-3-(3,4-dichlorophenoxy)-3-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-2-amino-3-(3,4-dichlorophenoxy)-3-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 139449306 |
| Molecular Formula | C9H9Cl2N3O3 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | (E)-2-amino-3-(3,4-dichlorophenoxy)-3-hydrazinylprop-2-enoic acid |
| SMILES | NN/C(Oc1ccc(Cl)c(Cl)c1)=C(\N)C(=O)O |
| InChI | InChI=1S/C9H9Cl2N3O3/c10-5-2-1-4(3-6(5)11)17-8(14-13)7(12)9(15)16/h1-3,14H,12-13H2,(H,15,16)/b8-7+ |
| InChIKey | PGQUPEOOVWTKAS-BQYQJAHWSA-N |
| XLogP | 1.05 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|