C33H41N7O3 — CID 139463533
(2S)-4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid (PubChem CID 139463533) has the molecular formula C33H41N7O3 and a molecular weight of 583.74 g/mol. Its IUPAC name is (2S)-4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463533 |
| Molecular Formula | C33H41N7O3 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | (2S)-4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
| SMILES | CCOCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1nc(-c2cccnc2)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C33H41N7O3/c1-2-43-22-21-40(19-6-5-11-26-15-14-24-9-8-18-35-30(24)36-26)20-16-29(33(41)42)38-32-27-12-3-4-13-28(27)37-31(39-32)25-10-7-17-34-23-25/h3-4,7,10,12-15,17,23,29H,2,5-6,8-9,11,16,18-22H2,1H3,(H,35,36)(H,41,42)(H,37,38,39)/t29-/m0/s1 |
| InChIKey | YRPQLTGXYPGRPM-LJAQVGFWSA-N |
| XLogP | 5.06 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|