C24H33N — CID 139468667
(3Z,5E)-N-[(3E)-3-ethenylpenta-1,3-dien-2-yl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine (PubChem CID 139468667) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is (3Z,5E)-N-[(3E)-3-ethenylpenta-1,3-dien-2-yl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine.
| Compound Name | (3Z,5E)-N-[(3E)-3-ethenylpenta-1,3-dien-2-yl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine |
|---|---|
| PubChem CID | 139468667 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (3Z,5E)-N-[(3E)-3-ethenylpenta-1,3-dien-2-yl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine |
| SMILES | C=CC/C(C)=C/C(=C/C(=C)N(C)C(=C)/C(C=C)=C/C)/C(=C\C)C(=C)C |
| InChI | InChI=1S/C24H33N/c1-11-15-19(7)16-23(24(14-4)18(5)6)17-20(8)25(10)21(9)22(12-2)13-3/h11-14,16-17H,1-2,5,8-9,15H2,3-4,6-7,10H3/b19-16+,22-13+,23-17-,24-14- |
| InChIKey | NFPPVZOZKNSCQJ-TVMAQQNJSA-N |
| XLogP | 7.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|