C18H25N — CID 138648661
(5E)-N-[(3Z)-3,6-dimethylhepta-1,3,5-trien-2-yl]-5-ethenylhepta-1,5-dien-4-imine (PubChem CID 138648661) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is (5E)-N-[(3Z)-3,6-dimethylhepta-1,3,5-trien-2-yl]-5-ethenylhepta-1,5-dien-4-imine.
| Compound Name | (5E)-N-[(3Z)-3,6-dimethylhepta-1,3,5-trien-2-yl]-5-ethenylhepta-1,5-dien-4-imine |
|---|---|
| PubChem CID | 138648661 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (5E)-N-[(3Z)-3,6-dimethylhepta-1,3,5-trien-2-yl]-5-ethenylhepta-1,5-dien-4-imine |
| SMILES | C=CCC(=N/C(=C)/C(C)=C\C=C(C)C)/C(C=C)=C/C |
| InChI | InChI=1S/C18H25N/c1-8-11-18(17(9-2)10-3)19-16(7)15(6)13-12-14(4)5/h8-10,12-13H,1-2,7,11H2,3-6H3/b15-13-,17-10+,19-18+ |
| InChIKey | OVRUBKGQOWTJTC-UCOXNMMPSA-N |
| XLogP | 5.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|