C20H30N2 — CID 142583808
acetylene;(2E,4Z,7Z)-7-N-methyl-4-[(3Z)-penta-1,3-dien-3-yl]-7-N-prop-1-en-2-ylnona-2,4,7-triene-2,7-diamine (PubChem CID 142583808) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is acetylene;(2E,4Z,7Z)-7-N-methyl-4-[(3Z)-penta-1,3-dien-3-yl]-7-N-prop-1-en-2-ylnona-2,4,7-triene-2,7-diamine.
| Compound Name | acetylene;(2E,4Z,7Z)-7-N-methyl-4-[(3Z)-penta-1,3-dien-3-yl]-7-N-prop-1-en-2-ylnona-2,4,7-triene-2,7-diamine |
|---|---|
| PubChem CID | 142583808 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | acetylene;(2E,4Z,7Z)-7-N-methyl-4-[(3Z)-penta-1,3-dien-3-yl]-7-N-prop-1-en-2-ylnona-2,4,7-triene-2,7-diamine |
| SMILES | C#C.C=C/C(=C/C)C(C=C(C)N)=CC/C(=C/C)N(C)C(=C)C |
| InChI | InChI=1S/C18H28N2.C2H2/c1-8-16(9-2)17(13-15(6)19)11-12-18(10-3)20(7)14(4)5;1-2/h8-11,13H,1,4,12,19H2,2-3,5-7H3;1-2H/b15-13+,16-9-,17-11-,18-10-; |
| InChIKey | ZLYHDSMVHQISAH-FZVUHPFLSA-N |
| XLogP | 4.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|