C25H33N — CID 142584841
(2E,4Z,7Z,9Z)-7-ethenyl-N,10-dimethyl-9-(2-methylprop-1-enyl)-4-[(3Z)-penta-1,3-dien-3-yl]dodeca-2,4,7,9-tetraen-11-yn-2-amine (PubChem CID 142584841) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is (2E,4Z,7Z,9Z)-7-ethenyl-N,10-dimethyl-9-(2-methylprop-1-enyl)-4-[(3Z)-penta-1,3-dien-3-yl]dodeca-2,4,7,9-tetraen-11-yn-2-amine.
| Compound Name | (2E,4Z,7Z,9Z)-7-ethenyl-N,10-dimethyl-9-(2-methylprop-1-enyl)-4-[(3Z)-penta-1,3-dien-3-yl]dodeca-2,4,7,9-tetraen-11-yn-2-amine |
|---|---|
| PubChem CID | 142584841 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | (2E,4Z,7Z,9Z)-7-ethenyl-N,10-dimethyl-9-(2-methylprop-1-enyl)-4-[(3Z)-penta-1,3-dien-3-yl]dodeca-2,4,7,9-tetraen-11-yn-2-amine |
| SMILES | C#C/C(C)=C(C=C(C)C)\C=C(/C=C)CC=C(/C=C(\C)NC)/C(C=C)=C\C |
| InChI | InChI=1S/C25H33N/c1-10-20(7)25(16-19(5)6)18-22(11-2)14-15-24(17-21(8)26-9)23(12-3)13-4/h1,11-13,15-18,26H,2-3,14H2,4-9H3/b21-17+,22-18+,23-13-,24-15-,25-20- |
| InChIKey | HIXRQQQOWDHFLI-XZPDLPOPSA-N |
| XLogP | 6.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|