C27H21N3O4S — CID 1394697
2-(3-benzylimidazol-3-ium-1-yl)-3-(4-methylphenyl)sulfonylimino-4-oxonaphthalen-1-olate (PubChem CID 1394697) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-(3-benzylimidazol-3-ium-1-yl)-3-(4-methylphenyl)sulfonylimino-4-oxonaphthalen-1-olate.
| Compound Name | 2-(3-benzylimidazol-3-ium-1-yl)-3-(4-methylphenyl)sulfonylimino-4-oxonaphthalen-1-olate |
|---|---|
| PubChem CID | 1394697 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-(3-benzylimidazol-3-ium-1-yl)-3-(4-methylphenyl)sulfonylimino-4-oxonaphthalen-1-olate |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C(=O)c3ccccc3C([O-])=C2n2cc[n+](Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H21N3O4S/c1-19-11-13-21(14-12-19)35(33,34)28-24-25(27(32)23-10-6-5-9-22(23)26(24)31)30-16-15-29(18-30)17-20-7-3-2-4-8-20/h2-16,18H,17H2,1H3 |
| InChIKey | WSIUAOGSFRZZHX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|