C23H18N2O4S — CID 73327694
3-(benzenesulfonylimino)-2-(3,5-dimethylpyridin-1-ium-1-yl)-4-oxonaphthalen-1-olate (PubChem CID 73327694) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is 3-(benzenesulfonylimino)-2-(3,5-dimethylpyridin-1-ium-1-yl)-4-oxonaphthalen-1-olate.
| Compound Name | 3-(benzenesulfonylimino)-2-(3,5-dimethylpyridin-1-ium-1-yl)-4-oxonaphthalen-1-olate |
|---|---|
| PubChem CID | 73327694 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 3-(benzenesulfonylimino)-2-(3,5-dimethylpyridin-1-ium-1-yl)-4-oxonaphthalen-1-olate |
| SMILES | Cc1cc(C)c[n+](C2=C([O-])c3ccccc3C(=O)C2=NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H18N2O4S/c1-15-12-16(2)14-25(13-15)21-20(24-30(28,29)17-8-4-3-5-9-17)22(26)18-10-6-7-11-19(18)23(21)27/h3-14H,1-2H3 |
| InChIKey | IJAJZQUMGJEIJS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|