C22H18N4O5S — CID 2324274
3-(4-acetamidophenyl)sulfonylimino-2-(3-methylimidazol-3-ium-1-yl)-4-oxonaphthalen-1-olate (PubChem CID 2324274) has the molecular formula C22H18N4O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 3-(4-acetamidophenyl)sulfonylimino-2-(3-methylimidazol-3-ium-1-yl)-4-oxonaphthalen-1-olate.
| Compound Name | 3-(4-acetamidophenyl)sulfonylimino-2-(3-methylimidazol-3-ium-1-yl)-4-oxonaphthalen-1-olate |
|---|---|
| PubChem CID | 2324274 |
| Molecular Formula | C22H18N4O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 3-(4-acetamidophenyl)sulfonylimino-2-(3-methylimidazol-3-ium-1-yl)-4-oxonaphthalen-1-olate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N=C2C(=O)c3ccccc3C([O-])=C2n2cc[n+](C)c2)cc1 |
| InChI | InChI=1S/C22H18N4O5S/c1-14(27)23-15-7-9-16(10-8-15)32(30,31)24-19-20(26-12-11-25(2)13-26)22(29)18-6-4-3-5-17(18)21(19)28/h3-13H,1-2H3,(H-,23,24,27,29) |
| InChIKey | DBCAVCSMMVDIQU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|