C22H27N2O2+ — CID 1394718
(3R)-3-(2,4-dimethylphenyl)-1-(2-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol (PubChem CID 1394718) has the molecular formula C22H27N2O2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is (3R)-3-(2,4-dimethylphenyl)-1-(2-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol.
| Compound Name | (3R)-3-(2,4-dimethylphenyl)-1-(2-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
|---|---|
| PubChem CID | 1394718 |
| Molecular Formula | C22H27N2O2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (3R)-3-(2,4-dimethylphenyl)-1-(2-methoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
| SMILES | COc1ccccc1N1C[C@](O)(c2ccc(C)cc2C)[N+]2=C1CCCC2 |
| InChI | InChI=1S/C22H27N2O2/c1-16-11-12-18(17(2)14-16)22(25)15-23(21-10-6-7-13-24(21)22)19-8-4-5-9-20(19)26-3/h4-5,8-9,11-12,14,25H,6-7,10,13,15H2,1-3H3/q+1/t22-/m0/s1 |
| InChIKey | KZEQYRNCSHAAKS-QFIPXVFZSA-N |
| XLogP | 3.57 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|