C30H37N7O2 — CID 139471902
(10E)-15-(2,6-dimethylphenyl)-18-methyl-6-(4-methylpiperazin-1-yl)-8-oxa-2,13,15,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,10,20-hexaen-14-one (PubChem CID 139471902) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is (10E)-15-(2,6-dimethylphenyl)-18-methyl-6-(4-methylpiperazin-1-yl)-8-oxa-2,13,15,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,10,20-hexaen-14-one.
| Compound Name | (10E)-15-(2,6-dimethylphenyl)-18-methyl-6-(4-methylpiperazin-1-yl)-8-oxa-2,13,15,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,10,20-hexaen-14-one |
|---|---|
| PubChem CID | 139471902 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | (10E)-15-(2,6-dimethylphenyl)-18-methyl-6-(4-methylpiperazin-1-yl)-8-oxa-2,13,15,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,10,20-hexaen-14-one |
| SMILES | Cc1cccc(C)c1N1CC2C3=NC(=NC2C)Nc2ccc(N4CCN(C)CC4)c(c2)OC/C=C\CN3C1=O |
| InChI | InChI=1S/C30H37N7O2/c1-20-8-7-9-21(2)27(20)37-19-24-22(3)31-29-32-23-10-11-25(35-15-13-34(4)14-16-35)26(18-23)39-17-6-5-12-36(30(37)38)28(24)33-29/h5-11,18,22,24H,12-17,19H2,1-4H3,(H,31,32)/b6-5- |
| InChIKey | KOGSZQNRHDGMFN-WAYWQWQTSA-N |
| XLogP | 4.13 |
| TPSA | 76.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|