C19H25BrN6O2 — CID 139472399
tert-butyl (3R)-3-[3-(4-amino-3-carbonobromidimidoylphenyl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate (PubChem CID 139472399) has the molecular formula C19H25BrN6O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-(4-amino-3-carbonobromidimidoylphenyl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-(4-amino-3-carbonobromidimidoylphenyl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139472399 |
| Molecular Formula | C19H25BrN6O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | tert-butyl (3R)-3-[3-(4-amino-3-carbonobromidimidoylphenyl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\Br)c1cc(-c2n[nH]c([C@@H]3CCCN(C(=O)OC(C)(C)C)C3)n2)ccc1N |
| InChI | InChI=1S/C19H25BrN6O2/c1-19(2,3)28-18(27)26-8-4-5-12(10-26)17-23-16(24-25-17)11-6-7-14(21)13(9-11)15(20)22/h6-7,9,12,22H,4-5,8,10,21H2,1-3H3,(H,23,24,25)/b22-15-/t12-/m1/s1 |
| InChIKey | VHOBWMAVOOIVRO-FLLWUHORSA-N |
| XLogP | 3.89 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|