C30H30ClF2N3O4 — CID 139478016
N-[3-chloro-5-(1,1-difluoroethyl)pyridine-2-carbonyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxamide (PubChem CID 139478016) has the molecular formula C30H30ClF2N3O4 and a molecular weight of 570.04 g/mol. Its IUPAC name is N-[3-chloro-5-(1,1-difluoroethyl)pyridine-2-carbonyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxamide.
| Compound Name | N-[3-chloro-5-(1,1-difluoroethyl)pyridine-2-carbonyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxamide |
|---|---|
| PubChem CID | 139478016 |
| Molecular Formula | C30H30ClF2N3O4 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | N-[3-chloro-5-(1,1-difluoroethyl)pyridine-2-carbonyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxamide |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)NC(=O)c4ncc(C(C)(F)F)cc4Cl)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C30H30ClF2N3O4/c1-5-6-19-11-17(2)24(18(3)12-19)25-22(37)14-30(15-23(25)38)7-9-36(10-8-30)28(40)35-27(39)26-21(31)13-20(16-34-26)29(4,32)33/h11-13,16,25H,7-10,14-15H2,1-4H3,(H,35,39,40) |
| InChIKey | YSJJIPCOHRMUMN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|