C30H32N2O5 — CID 160656801
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[3-(4-methoxy-2-pyridinyl)-3-oxopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 160656801) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[3-(4-methoxy-2-pyridinyl)-3-oxopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[3-(4-methoxy-2-pyridinyl)-3-oxopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 160656801 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-[3-(4-methoxy-2-pyridinyl)-3-oxopropanoyl]-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)CC(=O)c4cc(OC)ccn4)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C30H32N2O5/c1-5-6-21-13-19(2)28(20(3)14-21)29-25(34)17-30(18-26(29)35)8-11-32(12-9-30)27(36)16-24(33)23-15-22(37-4)7-10-31-23/h7,10,13-15,29H,8-9,11-12,16-18H2,1-4H3 |
| InChIKey | RLDSLKPJZLVANE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|