C38H56O5 — CID 139479851
benzyl (4R)-4-[(5R,7S,8E,15R)-8-ethylidene-7,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoate (PubChem CID 139479851) has the molecular formula C38H56O5 and a molecular weight of 592.86 g/mol. Its IUPAC name is benzyl (4R)-4-[(5R,7S,8E,15R)-8-ethylidene-7,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoate.
| Compound Name | benzyl (4R)-4-[(5R,7S,8E,15R)-8-ethylidene-7,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoate |
|---|---|
| PubChem CID | 139479851 |
| Molecular Formula | C38H56O5 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.41 |
| IUPAC Name | benzyl (4R)-4-[(5R,7S,8E,15R)-8-ethylidene-7,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoate |
| SMILES | C/C=C1/C(=O)C2C(CCC[C@@H](OC3CCCCO3)C[C@@H]1C)CC[C@@]1(C)C2CCC1[C@H](C)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H56O5/c1-5-31-27(3)24-30(43-35-16-9-10-23-41-35)15-11-14-29-21-22-38(4)32(18-19-33(38)36(29)37(31)40)26(2)17-20-34(39)42-25-28-12-7-6-8-13-28/h5-8,12-13,26-27,29-30,32-33,35-36H,9-11,14-25H2,1-4H3/b31-5+/t26-,27+,29?,30-,32?,33?,35?,36?,38-/m1/s1 |
| InChIKey | ASCGCPZIOMNHOX-OOUOIZISSA-N |
| XLogP | 8.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|