C31H50O5 — CID 174100925
(4R)-4-[(2S,8E,15R)-8-ethylidene-2,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoic acid (PubChem CID 174100925) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is (4R)-4-[(2S,8E,15R)-8-ethylidene-2,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoic acid.
| Compound Name | (4R)-4-[(2S,8E,15R)-8-ethylidene-2,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoic acid |
|---|---|
| PubChem CID | 174100925 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | (4R)-4-[(2S,8E,15R)-8-ethylidene-2,15-dimethyl-5-(oxan-2-yloxy)-9-oxo-14-tricyclo[8.7.0.011,15]heptadecanyl]pentanoic acid |
| SMILES | C/C=C1\CCC(OC2CCCCO2)CC[C@H](C)C2CC[C@@]3(C)C(CCC3[C@H](C)CCC(=O)O)C2C1=O |
| InChI | InChI=1S/C31H50O5/c1-5-22-11-13-23(36-28-8-6-7-19-35-28)12-9-20(2)24-17-18-31(4)25(21(3)10-16-27(32)33)14-15-26(31)29(24)30(22)34/h5,20-21,23-26,28-29H,6-19H2,1-4H3,(H,32,33)/b22-5+/t20-,21+,23?,24?,25?,26?,28?,29?,31+/m0/s1 |
| InChIKey | IGTWEELMDYGTKL-KBKCNYCKSA-N |
| XLogP | 7.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|