C24H26F2O — CID 139480711
4-[3-fluoro-4-[2-[2-(4-fluorophenyl)cyclopenten-1-yl]ethyl]phenyl]-3-methylbut-1-en-2-ol (PubChem CID 139480711) has the molecular formula C24H26F2O and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-[3-fluoro-4-[2-[2-(4-fluorophenyl)cyclopenten-1-yl]ethyl]phenyl]-3-methylbut-1-en-2-ol.
| Compound Name | 4-[3-fluoro-4-[2-[2-(4-fluorophenyl)cyclopenten-1-yl]ethyl]phenyl]-3-methylbut-1-en-2-ol |
|---|---|
| PubChem CID | 139480711 |
| Molecular Formula | C24H26F2O |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-[3-fluoro-4-[2-[2-(4-fluorophenyl)cyclopenten-1-yl]ethyl]phenyl]-3-methylbut-1-en-2-ol |
| SMILES | C=C(O)C(C)Cc1ccc(CCC2=C(c3ccc(F)cc3)CCC2)c(F)c1 |
| InChI | InChI=1S/C24H26F2O/c1-16(17(2)27)14-18-6-7-21(24(26)15-18)9-8-19-4-3-5-23(19)20-10-12-22(25)13-11-20/h6-7,10-13,15-16,27H,2-5,8-9,14H2,1H3 |
| InChIKey | JKXAGBSMFFZLAY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|