C27H32N8O2 — CID 139482509
4-[(3-methyl-2,3-dihydrofuro[2,3-b]pyridin-5-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 139482509) has the molecular formula C27H32N8O2 and a molecular weight of 500.61 g/mol. Its IUPAC name is 4-[(3-methyl-2,3-dihydrofuro[2,3-b]pyridin-5-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 4-[(3-methyl-2,3-dihydrofuro[2,3-b]pyridin-5-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 139482509 |
| Molecular Formula | C27H32N8O2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 4-[(3-methyl-2,3-dihydrofuro[2,3-b]pyridin-5-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cnc2c(c1)C(C)CO2 |
| InChI | InChI=1S/C27H32N8O2/c1-4-9-28-25(36)23-16-30-27(32-19-5-7-21(8-6-19)35-12-10-34(3)11-13-35)33-24(23)31-20-14-22-18(2)17-37-26(22)29-15-20/h4-8,14-16,18H,1,9-13,17H2,2-3H3,(H,28,36)(H2,30,31,32,33) |
| InChIKey | JZIAJXYTHMBEOY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|