C25H28F3N9O2 — CID 166899064
2-[4-(4-methylpiperazin-1-yl)anilino]-4-[[6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-3-yl]amino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 166899064) has the molecular formula C25H28F3N9O2 and a molecular weight of 543.55 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)anilino]-4-[[6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-3-yl]amino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-4-[[6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-3-yl]amino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 166899064 |
| Molecular Formula | C25H28F3N9O2 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-4-[[6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-3-yl]amino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1ccc(=O)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C25H28F3N9O2/c1-3-10-29-23(39)19-15-30-24(31-17-4-6-18(7-5-17)36-13-11-35(2)12-14-36)33-22(19)32-20-8-9-21(38)37(34-20)16-25(26,27)28/h3-9,15H,1,10-14,16H2,2H3,(H,29,39)(H2,30,31,32,33,34) |
| InChIKey | NBRIEDGNQIJASR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|