C32H40N8O3 — CID 171098604
4-[[(7R)-7-ethyl-7-hydroxy-5,6-dihydrocyclopenta[b]pyridin-2-yl]amino]-2-[4-[4-(4-oxobutyl)piperazin-1-yl]anilino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 171098604) has the molecular formula C32H40N8O3 and a molecular weight of 584.73 g/mol. Its IUPAC name is 4-[[(7R)-7-ethyl-7-hydroxy-5,6-dihydrocyclopenta[b]pyridin-2-yl]amino]-2-[4-[4-(4-oxobutyl)piperazin-1-yl]anilino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 4-[[(7R)-7-ethyl-7-hydroxy-5,6-dihydrocyclopenta[b]pyridin-2-yl]amino]-2-[4-[4-(4-oxobutyl)piperazin-1-yl]anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 171098604 |
| Molecular Formula | C32H40N8O3 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 4-[[(7R)-7-ethyl-7-hydroxy-5,6-dihydrocyclopenta[b]pyridin-2-yl]amino]-2-[4-[4-(4-oxobutyl)piperazin-1-yl]anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(N3CCN(CCCC=O)CC3)cc2)nc1Nc1ccc2c(n1)[C@@](O)(CC)CC2 |
| InChI | InChI=1S/C32H40N8O3/c1-3-15-33-30(42)26-22-34-31(38-29(26)37-27-12-7-23-13-14-32(43,4-2)28(23)36-27)35-24-8-10-25(11-9-24)40-19-17-39(18-20-40)16-5-6-21-41/h3,7-12,21-22,43H,1,4-6,13-20H2,2H3,(H,33,42)(H2,34,35,36,37,38)/t32-/m1/s1 |
| InChIKey | QJOLUDBHVLWYRN-JGCGQSQUSA-N |
| XLogP | 3.92 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|