C29H39N9O — CID 156524081
4-[(8-amino-8-methyl-3,5,6,7-tetrahydro-2H-quinolin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 156524081) has the molecular formula C29H39N9O and a molecular weight of 529.69 g/mol. Its IUPAC name is 4-[(8-amino-8-methyl-3,5,6,7-tetrahydro-2H-quinolin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 4-[(8-amino-8-methyl-3,5,6,7-tetrahydro-2H-quinolin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 156524081 |
| Molecular Formula | C29H39N9O |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 4-[(8-amino-8-methyl-3,5,6,7-tetrahydro-2H-quinolin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1NC1CC=C2CCCC(C)(N)C2=N1 |
| InChI | InChI=1S/C29H39N9O/c1-4-14-31-27(39)23-19-32-28(33-21-8-10-22(11-9-21)38-17-15-37(3)16-18-38)36-26(23)35-24-12-7-20-6-5-13-29(2,30)25(20)34-24/h4,7-11,19,24H,1,5-6,12-18,30H2,2-3H3,(H,31,39)(H2,32,33,35,36) |
| InChIKey | JZYLSNBPFOZALW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|