C18H22Cl3N3O2 — CID 139487210
3,3-dimethyl-N-(4,5,6-trichloro-1-cyclobutyl-7-methoxybenzimidazol-2-yl)butanamide (PubChem CID 139487210) has the molecular formula C18H22Cl3N3O2 and a molecular weight of 418.75 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4,5,6-trichloro-1-cyclobutyl-7-methoxybenzimidazol-2-yl)butanamide.
| Compound Name | 3,3-dimethyl-N-(4,5,6-trichloro-1-cyclobutyl-7-methoxybenzimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 139487210 |
| Molecular Formula | C18H22Cl3N3O2 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3,3-dimethyl-N-(4,5,6-trichloro-1-cyclobutyl-7-methoxybenzimidazol-2-yl)butanamide |
| SMILES | COc1c(Cl)c(Cl)c(Cl)c2nc(NC(=O)CC(C)(C)C)n(C3CCC3)c12 |
| InChI | InChI=1S/C18H22Cl3N3O2/c1-18(2,3)8-10(25)22-17-23-14-12(20)11(19)13(21)16(26-4)15(14)24(17)9-6-5-7-9/h9H,5-8H2,1-4H3,(H,22,23,25) |
| InChIKey | DTUPELQWIUPVQL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|