C23H24F4N2O3S — CID 139492785
7-[2-ethyl-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]-2,2,4,4-tetrafluorotricyclo[3.3.1.03,9]nona-1(8),5(9),6-trien-3-ol (PubChem CID 139492785) has the molecular formula C23H24F4N2O3S and a molecular weight of 484.52 g/mol. Its IUPAC name is 7-[2-ethyl-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]-2,2,4,4-tetrafluorotricyclo[3.3.1.03,9]nona-1(8),5(9),6-trien-3-ol.
| Compound Name | 7-[2-ethyl-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]-2,2,4,4-tetrafluorotricyclo[3.3.1.03,9]nona-1(8),5(9),6-trien-3-ol |
|---|---|
| PubChem CID | 139492785 |
| Molecular Formula | C23H24F4N2O3S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 7-[2-ethyl-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]-2,2,4,4-tetrafluorotricyclo[3.3.1.03,9]nona-1(8),5(9),6-trien-3-ol |
| SMILES | CCc1cc(CN2CCN(S(C)(=O)=O)CC2)ccc1-c1cc2c3c(c1)C(F)(F)C3(O)C2(F)F |
| InChI | InChI=1S/C23H24F4N2O3S/c1-3-15-10-14(13-28-6-8-29(9-7-28)33(2,31)32)4-5-17(15)16-11-18-20-19(12-16)23(26,27)21(20,30)22(18,24)25/h4-5,10-12,30H,3,6-9,13H2,1-2H3 |
| InChIKey | YZZFVEOINAHDCB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |