C21H21BrF6N2O3S — CID 163501360
2-[4-[2-bromo-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 163501360) has the molecular formula C21H21BrF6N2O3S and a molecular weight of 575.37 g/mol. Its IUPAC name is 2-[4-[2-bromo-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[2-bromo-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 163501360 |
| Molecular Formula | C21H21BrF6N2O3S |
| Molecular Weight | 575.37 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 2-[4-[2-bromo-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)N1CCN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c(Br)c2)CC1 |
| InChI | InChI=1S/C21H21BrF6N2O3S/c1-34(32,33)30-10-8-29(9-11-30)13-14-2-7-17(18(22)12-14)15-3-5-16(6-4-15)19(31,20(23,24)25)21(26,27)28/h2-7,12,31H,8-11,13H2,1H3 |
| InChIKey | CVALGXJHTLRPEM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |