C23H23F7N2O3S — CID 139503091
1,1,1,3,3,3-hexafluoro-2-[4-[2-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]propan-2-ol (PubChem CID 139503091) has the molecular formula C23H23F7N2O3S and a molecular weight of 540.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[2-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[2-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 139503091 |
| Molecular Formula | C23H23F7N2O3S |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[2-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]propan-2-ol |
| SMILES | CS(=O)(=O)N1C2CCC1CN(Cc1ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c(F)c1)C2 |
| InChI | InChI=1S/C23H23F7N2O3S/c1-36(34,35)32-17-7-8-18(32)13-31(12-17)11-14-2-9-19(20(24)10-14)15-3-5-16(6-4-15)21(33,22(25,26)27)23(28,29)30/h2-6,9-10,17-18,33H,7-8,11-13H2,1H3 |
| InChIKey | WQPJSSJZSGLLKQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |