C25H26ClF7N2O3S — CID 139490317
2-[3-chloro-4-[2-ethyl-5-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 139490317) has the molecular formula C25H26ClF7N2O3S and a molecular weight of 603.00 g/mol. Its IUPAC name is 2-[3-chloro-4-[2-ethyl-5-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-chloro-4-[2-ethyl-5-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 139490317 |
| Molecular Formula | C25H26ClF7N2O3S |
| Molecular Weight | 603.00 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | 2-[3-chloro-4-[2-ethyl-5-fluoro-4-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCc1cc(CN2CC3CCC(C2)N3S(C)(=O)=O)c(F)cc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C25H26ClF7N2O3S/c1-3-14-8-15(11-34-12-17-5-6-18(13-34)35(17)39(2,37)38)22(27)10-20(14)19-7-4-16(9-21(19)26)23(36,24(28,29)30)25(31,32)33/h4,7-10,17-18,36H,3,5-6,11-13H2,1-2H3 |
| InChIKey | CAJGGKRQKWBSQE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |