C24H23F9N2O3S — CID 150215559
2-[4-[2-ethyl-3,6-difluoro-4-[(2-methylsulfonyl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]phenyl]-3-fluorophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 150215559) has the molecular formula C24H23F9N2O3S and a molecular weight of 590.51 g/mol. Its IUPAC name is 2-[4-[2-ethyl-3,6-difluoro-4-[(2-methylsulfonyl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]phenyl]-3-fluorophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[2-ethyl-3,6-difluoro-4-[(2-methylsulfonyl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]phenyl]-3-fluorophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 150215559 |
| Molecular Formula | C24H23F9N2O3S |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 2-[4-[2-ethyl-3,6-difluoro-4-[(2-methylsulfonyl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]phenyl]-3-fluorophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCc1c(F)c(CN2CC3(C2)CN(S(C)(=O)=O)C3)cc(F)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C24H23F9N2O3S/c1-3-15-19(16-5-4-14(7-17(16)25)22(36,23(28,29)30)24(31,32)33)18(26)6-13(20(15)27)8-34-9-21(10-34)11-35(12-21)39(2,37)38/h4-7,36H,3,8-12H2,1-2H3 |
| InChIKey | FSKBAUUULYQFCG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |