C24H25ClF8N2O3S — CID 139503664
5-[[[4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorophenyl]methylamino]methyl]-1-methylsulfinylpyrrolidin-2-ol (PubChem CID 139503664) has the molecular formula C24H25ClF8N2O3S and a molecular weight of 608.98 g/mol. Its IUPAC name is 5-[[[4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorophenyl]methylamino]methyl]-1-methylsulfinylpyrrolidin-2-ol.
| Compound Name | 5-[[[4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorophenyl]methylamino]methyl]-1-methylsulfinylpyrrolidin-2-ol |
|---|---|
| PubChem CID | 139503664 |
| Molecular Formula | C24H25ClF8N2O3S |
| Molecular Weight | 608.98 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 5-[[[4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorophenyl]methylamino]methyl]-1-methylsulfinylpyrrolidin-2-ol |
| SMILES | CCc1c(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2Cl)cc(F)c(CNCC2CCC(O)N2S(C)=O)c1F |
| InChI | InChI=1S/C24H25ClF8N2O3S/c1-3-14-16(15-6-4-12(8-18(15)25)22(37,23(28,29)30)24(31,32)33)9-19(26)17(21(14)27)11-34-10-13-5-7-20(36)35(13)39(2)38/h4,6,8-9,13,20,34,36-37H,3,5,7,10-11H2,1-2H3 |
| InChIKey | NCNUZBSHOOXMKS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |