C18H11ClF8O2 — CID 139490433
4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorobenzaldehyde (PubChem CID 139490433) has the molecular formula C18H11ClF8O2 and a molecular weight of 446.72 g/mol. Its IUPAC name is 4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorobenzaldehyde.
| Compound Name | 4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorobenzaldehyde |
|---|---|
| PubChem CID | 139490433 |
| Molecular Formula | C18H11ClF8O2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 4-[2-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-ethyl-2,6-difluorobenzaldehyde |
| SMILES | CCc1c(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2Cl)cc(F)c(C=O)c1F |
| InChI | InChI=1S/C18H11ClF8O2/c1-2-9-11(6-14(20)12(7-28)15(9)21)10-4-3-8(5-13(10)19)16(29,17(22,23)24)18(25,26)27/h3-7,29H,2H2,1H3 |
| InChIKey | ZYQKPCGOXIEQMZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|