About 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine
5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 139495242) has the molecular formula C17H8ClF2N3S
and a molecular weight of 359.79 g/mol. Its IUPAC name is 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine |
| PubChem CID | 139495242 |
| Molecular Formula | C17H8ClF2N3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Fc1ccc(-c2ncccc2-c2ccc3ncsc3n2)c(F)c1Cl |
| InChI | InChI=1S/C17H8ClF2N3S/c18-14-11(19)4-3-10(15(14)20)16-9(2-1-7-21-16)12-5-6-13-17(23-12)24-8-22-13/h1-8H |
| InChIKey | FIQZCTUMADFKHY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine?
The IUPAC name of 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine (CID 139495242) is 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine.
What is the SMILES notation for 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine?
The canonical SMILES for 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine is Fc1ccc(-c2ncccc2-c2ccc3ncsc3n2)c(F)c1Cl.
What is the InChIKey of 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine?
The InChIKey is FIQZCTUMADFKHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8ClF2N3S/c18-14-11(19)4-3-10(15(14)20)16-9(2-1-7-21-16)12-5-6-13-17(23-12)24-8-22-13/h1-8H.
What are the key properties of 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine?
5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine has a molecular weight of 359.79 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]-[1,3]thiazolo[5,4-b]pyridine is sourced from PubChem (CID 139495242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).