C15H18ClN3 — CID 139499873
2-chloro-4-hexan-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 139499873) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 2-chloro-4-hexan-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-hexan-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139499873 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-chloro-4-hexan-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | CCCCC(C)c1nc(Cl)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H18ClN3/c1-3-4-8-11(2)13-17-14(19-15(16)18-13)12-9-6-5-7-10-12/h5-7,9-11H,3-4,8H2,1-2H3 |
| InChIKey | CXRDHZARDHYFCS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |